cas: 2246654-50-0 — see every product listed under this CAS number, including other names
3-(2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-1,1-dimethylurea, 95%, 95% (CAS 2246654-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11UCN1-100mg |
| cas | 2246654-50-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1715.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-dimethylurea (CAS 2246654-50-0) is a chemical compound with the molecular formula C15H22BClN2O3 and a molecular weight of 324.6 g/mol. IUPAC name: 3-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-dimethylurea. InChIKey: LISQCYXTDYOYRI-UHFFFAOYSA-N.
| Molecular formula | C15H22BClN2O3 |
|---|---|
| Molecular weight | 324.6 g/mol |
| IUPAC name | 3-[2-chloro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,1-dimethylurea |
| InChIKey | LISQCYXTDYOYRI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)NC(=O)N(C)C |
Computed by PubChem (NCBI)