cas: 745055-24-7 — see every product listed under this CAS number, including other names
3-(3-(4-(2-Methoxyethoxy)phenyl)-1,2,4-oxadiazol-5-yl)benzoic acid, 95%, 95% (CAS 745055-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114IRX-100mg |
| cas | 745055-24-7 |
| size | 100mg |
| availability | 1.31g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 957.20 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 4610.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[3-[4-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]benzoic acid (CAS 745055-24-7) is a chemical compound with the molecular formula C18H16N2O5 and a molecular weight of 340.3 g/mol. IUPAC name: 3-[3-[4-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]benzoic acid. InChIKey: GHZLPZGBHDIIPA-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O5 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 3-[3-[4-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]benzoic acid |
| InChIKey | GHZLPZGBHDIIPA-UHFFFAOYSA-N |
| SMILES | COCCOC1=CC=C(C=C1)C2=NOC(=N2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)