cas: 21172-43-0 — see every product listed under this CAS number, including other names
3-(3-(Trifluoromethyl)phenyl)propyl methanesulfonate, 97% (CAS 21172-43-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A841560-100mg |
| cas | 21172-43-0 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1549.62 Pln | |
| Ambeed | 5g | 4514.44 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1669.44 Pln | |
| BLDpharm | 5g | 4862.76 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-[3-(trifluoromethyl)phenyl]propyl methanesulfonate (CAS 21172-43-0) is a chemical compound with the molecular formula C11H13F3O3S and a molecular weight of 282.28 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]propyl methanesulfonate. InChIKey: UUMKCYVXQLVAHM-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O3S |
|---|---|
| Molecular weight | 282.28 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]propyl methanesulfonate |
| InChIKey | UUMKCYVXQLVAHM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCCC1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)