cas: 913835-31-1 — see every product listed under this CAS number, including other names
3-(3-BROMOPHENYLSULFONAMIDO)PHENYLBORONIC ACID, 95%, 95% (CAS 913835-31-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTDB-250mg |
| cas | 913835-31-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1562.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-[(3-bromophenyl)sulfonylamino]phenyl]boronic acid (CAS 913835-31-1) is a chemical compound with the molecular formula C12H11BBrNO4S and a molecular weight of 356.00 g/mol. IUPAC name: [3-[(3-bromophenyl)sulfonylamino]phenyl]boronic acid. InChIKey: AJQSIDSDMAZIHA-UHFFFAOYSA-N.
| Molecular formula | C12H11BBrNO4S |
|---|---|
| Molecular weight | 356.00 g/mol |
| IUPAC name | [3-[(3-bromophenyl)sulfonylamino]phenyl]boronic acid |
| InChIKey | AJQSIDSDMAZIHA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NS(=O)(=O)C2=CC(=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)