cas: 1951441-01-2 — see every product listed under this CAS number, including other names
3-(3-Chlorophenyl)-5,6,7,8-tetrahydroimidazo(1,2-a)pyrazine hydrochloride, 97% (CAS 1951441-01-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A398871-1g |
| cas | 1951441-01-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8617.63 Pln | |
| AmBeed | 5g | 24586.66 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(3-chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;hydrochloride (CAS 1951441-01-2) is a chemical compound with the molecular formula C12H13Cl2N3 and a molecular weight of 270.15 g/mol. IUPAC name: 3-(3-chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;hydrochloride. InChIKey: KYQMZKBLCYREPL-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl2N3 |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine;hydrochloride |
| InChIKey | KYQMZKBLCYREPL-UHFFFAOYSA-N |
| SMILES | C1CN2C(=NC=C2C3=CC(=CC=C3)Cl)CN1.Cl |
Computed by PubChem (NCBI)