3-(3-Methyl-2-oxo-4-(piperazin-1-yl)-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-2,6-dione 2,2,2-trifluoroacetate, 95%
cas: 2654057-01-7 — see every product listed under this CAS number, including other names
3-(3-Methyl-2-oxo-4-(piperazin-1-yl)-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-2,6-dione 2,2,2-trifluoroacetate, 95% (CAS 2654057-01-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2814384-10mg |
| cas | 2654057-01-7 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 353.69 Pln | |
| Ambeed | 25mg | 615.13 Pln | |
| Ambeed | 50mg | 993.38 Pln | |
| Ambeed | 100mg | 1638.62 Pln | |
| Ambeed | 250mg | 2884.62 Pln | |
| Ambeed | 1g | 7668.38 Pln | |
| BLDpharm | 10mg | 375.45 Pln | |
| BLDpharm | 25mg | 658.68 Pln | |
| BLDpharm | 50mg | 1064.09 Pln | |
| BLDpharm | 100mg | 1758.29 Pln | |
| BLDpharm | 250mg | 3107.82 Pln | |
| BLDpharm | 1g | 8261.56 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(3-methyl-2-oxo-4-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid (CAS 2654057-01-7) is a chemical compound with the molecular formula C19H22F3N5O5 and a molecular weight of 457.4 g/mol. IUPAC name: 3-(3-methyl-2-oxo-4-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid. InChIKey: PNPOZEFALXLJND-UHFFFAOYSA-N.
| Molecular formula | C19H22F3N5O5 |
|---|---|
| Molecular weight | 457.4 g/mol |
| IUPAC name | 3-(3-methyl-2-oxo-4-piperazin-1-ylbenzimidazol-1-yl)piperidine-2,6-dione;2,2,2-trifluoroacetic acid |
| InChIKey | PNPOZEFALXLJND-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2N3CCNCC3)N(C1=O)C4CCC(=O)NC4=O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)