cas: 4385-67-5 — see every product listed under this CAS number, including other names
3-(3-Methylphenyl)pyridine, ≥97-<99% (CAS 4385-67-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC4591-97-99-500mg |
| cas | 4385-67-5 |
| size | 500mg |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 500mg | 4531.56 Pln | |
| Hoffman Fine Chemicals | 1g | 5998.96 Pln | |
| Hoffman Fine Chemicals | 2,5g | 10267.18 Pln | |
| Hoffman Fine Chemicals | 5g | 19377.82 Pln | |
| Hoffman Fine Chemicals | 10g | 30810.78 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
3-(3-methylphenyl)pyridine (CAS 4385-67-5) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 3-(3-methylphenyl)pyridine. InChIKey: LONDBHTYIYKOCM-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 3-(3-methylphenyl)pyridine |
| InChIKey | LONDBHTYIYKOCM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)