cas: 1073354-46-7 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine 98% (CAS 1073354-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A437999-100mg |
| cas | 1073354-46-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 3134.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A437999 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine (CAS 1073354-46-7) is a chemical compound with the molecular formula C13H17BF3NO3 and a molecular weight of 303.09 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: JSYVVFGMCOWXSP-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO3 |
|---|---|
| Molecular weight | 303.09 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | JSYVVFGMCOWXSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)OCC(F)(F)F |
Computed by PubChem (NCBI)