cas: 878194-93-5 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)picolinonitrile 97% (CAS 878194-93-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A669879-250mg |
| cas | 878194-93-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 420.44 Pln | |
| Ambeed | 5g | 1004.50 Pln | |
| Ambeed | 10g | 1927.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A669879 |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile (CAS 878194-93-5) is a chemical compound with the molecular formula C12H15BN2O2 and a molecular weight of 230.07 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile. InChIKey: CZYZGSPKMBKQBK-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carbonitrile |
| InChIKey | CZYZGSPKMBKQBK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)C#N |
Computed by PubChem (NCBI)