cas: 1191063-90-7 — see every product listed under this CAS number, including other names
3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid, 98%, 98% (CAS 1191063-90-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111I8S-100mg |
| cas | 1191063-90-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 2013.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid (CAS 1191063-90-7) is a chemical compound with the molecular formula C9H17BO4 and a molecular weight of 200.04 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid. InChIKey: KOEHRDXIOARYAC-UHFFFAOYSA-N.
| Molecular formula | C9H17BO4 |
|---|---|
| Molecular weight | 200.04 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoic acid |
| InChIKey | KOEHRDXIOARYAC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(=O)O |
Computed by PubChem (NCBI)