cas: 20529-23-1 — see every product listed under this CAS number, including other names
3-(4-(2-Methoxyphenyl)piperazin-1-yl)propan-1-amine, 97.0% (HPLC), 97.0% (HPLC) (CAS 20529-23-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJEN-200mg |
| cas | 20529-23-1 |
| size | 200mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 371.60 Pln | |
| Chemat | 1g | 1000.40 Pln | |
| Chemat | 5g | 2032.40 Pln |
| purity | 97.0% (HPLC) |
|---|---|
| delivery time | 3 weeks |
3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine (CAS 20529-23-1) is a chemical compound with the molecular formula C14H23N3O and a molecular weight of 249.35 g/mol. IUPAC name: 3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine. InChIKey: OVGGXHMQXIQOBR-UHFFFAOYSA-N.
| Molecular formula | C14H23N3O |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | 3-[4-(2-methoxyphenyl)piperazin-1-yl]propan-1-amine |
| InChIKey | OVGGXHMQXIQOBR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCCN |
Computed by PubChem (NCBI)