3-(4-(Aminomethyl)-2,6-dichlorophenyl)piperidine-2,6-dione hydrochloride, 95%
cas: 3069895-40-2 — see every product listed under this CAS number, including other names
3-(4-(Aminomethyl)-2,6-dichlorophenyl)piperidine-2,6-dione hydrochloride, 95% (CAS 3069895-40-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A2944148-100mg |
| cas | 3069895-40-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 832.06 Pln | |
| Ambeed | 250mg | 1610.81 Pln | |
| Ambeed | 1g | 4720.25 Pln | |
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1221.20 Pln | |
| Chemat | 500mg | 2382.80 Pln | |
| Chemat | 1g | 3467.60 Pln | |
| Chemat | 5g | 13605.20 Pln | |
| BLDpharm | 100mg | 891.93 Pln | |
| BLDpharm | 250mg | 1730.53 Pln | |
| BLDpharm | 1g | 5084.90 Pln | |
| Fluorochem | 100mg | 851.80 Pln | |
| Fluorochem | 250mg | 1653.60 Pln | |
| Fluorochem | 5g | 18007.22 Pln | |
| Fluorochem | 1g | 4662.96 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-[4-(aminomethyl)-2,6-dichlorophenyl]piperidine-2,6-dione;hydrochloride (CAS 3069895-40-2) is a chemical compound with the molecular formula C12H13Cl3N2O2 and a molecular weight of 323.6 g/mol. IUPAC name: 3-[4-(aminomethyl)-2,6-dichlorophenyl]piperidine-2,6-dione;hydrochloride. InChIKey: SXIXVKFCLBHFJJ-UHFFFAOYSA-N.
| Molecular formula | C12H13Cl3N2O2 |
|---|---|
| Molecular weight | 323.6 g/mol |
| IUPAC name | 3-[4-(aminomethyl)-2,6-dichlorophenyl]piperidine-2,6-dione;hydrochloride |
| InChIKey | SXIXVKFCLBHFJJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2Cl)CN)Cl.Cl |
Computed by PubChem (NCBI)