CAS 3476-86-6 appears in our catalog under these names: SU5205, SU 5205, SU5205 99%, Su5205, 97%, 97%, SU5205, 98.02%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25mg, 100mg, 250mg, 50mg, 10mg, 1g, 50 mg, 100 mg.
(3Z)-3-[(4-fluorophenyl)methylidene]-1H-indol-2-one (CAS 3476-86-6) is a chemical compound with the molecular formula C15H10FNO and a molecular weight of 239.24 g/mol. IUPAC name: (3Z)-3-[(4-fluorophenyl)methylidene]-1H-indol-2-one. InChIKey: QIERHADIMMFZNE-LCYFTJDESA-N.
| Molecular formula | C15H10FNO |
|---|---|
| Molecular weight | 239.24 g/mol |
| IUPAC name | (3Z)-3-[(4-fluorophenyl)methylidene]-1H-indol-2-one |
| InChIKey | QIERHADIMMFZNE-LCYFTJDESA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=CC=C(C=C3)F)/C(=O)N2 |
Computed by PubChem (NCBI)