cas: 1159803-47-0 — see every product listed under this CAS number, including other names
3-(4-Methylphenyl)-2,4-diaza-3-boratricyclo[7.3.1.0(5,13)]trideca-1(13),5,7,9,11-pentaene, 95%, 95% (CAS 1159803-47-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HD66-100mg |
| cas | 1159803-47-0 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1274.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4-methylphenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (CAS 1159803-47-0) is a chemical compound with the molecular formula C17H15BN2 and a molecular weight of 258.1 g/mol. IUPAC name: 3-(4-methylphenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene. InChIKey: VPFSXFHFLDYAKY-UHFFFAOYSA-N.
| Molecular formula | C17H15BN2 |
|---|---|
| Molecular weight | 258.1 g/mol |
| IUPAC name | 3-(4-methylphenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| InChIKey | VPFSXFHFLDYAKY-UHFFFAOYSA-N |
| SMILES | B1(NC2=CC=CC3=C2C(=CC=C3)N1)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)