cas: 1565540-62-6 — see every product listed under this CAS number, including other names
3-(4-Methylpiperazin-1-yl)pyridin-2-amine 97% (CAS 1565540-62-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A308715-100mg |
| cas | 1565540-62-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 765.31 Pln | |
| Ambeed | 250mg | 1254.81 Pln | |
| Ambeed | 1g | 3251.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A308715 |
3-(4-methylpiperazin-1-yl)pyridin-2-amine (CAS 1565540-62-6) is a chemical compound with the molecular formula C10H16N4 and a molecular weight of 192.26 g/mol. IUPAC name: 3-(4-methylpiperazin-1-yl)pyridin-2-amine. InChIKey: BOMRADAXQDYILQ-UHFFFAOYSA-N.
| Molecular formula | C10H16N4 |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 3-(4-methylpiperazin-1-yl)pyridin-2-amine |
| InChIKey | BOMRADAXQDYILQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(N=CC=C2)N |
Computed by PubChem (NCBI)