cas: 1438272-88-8 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-5-fluoroaniline, 97% (CAS 1438272-88-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A664911-5g |
| cas | 1438272-88-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15134.14 Pln | |
| Fluorochem | 250mg | 1002.79 Pln | |
| Fluorochem | 1g | 2236.73 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-fluoro-5-phenylmethoxyaniline (CAS 1438272-88-8) is a chemical compound with the molecular formula C13H12FNO and a molecular weight of 217.24 g/mol. IUPAC name: 3-fluoro-5-phenylmethoxyaniline. InChIKey: LZQGNCOYPBHWQE-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | 3-fluoro-5-phenylmethoxyaniline |
| InChIKey | LZQGNCOYPBHWQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)N)F |
Computed by PubChem (NCBI)