cas: 1228956-98-6 — see every product listed under this CAS number, including other names
3-(Benzyloxy)-6-bromo-2-fluorophenol, 97%, 97% (CAS 1228956-98-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111JQK-100mg |
| cas | 1228956-98-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 500mg | 549.20 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2306.00 Pln | |
| Chemat | 10g | 3875.60 Pln | |
| Chemat | 25g | 8157.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-bromo-2-fluoro-3-phenylmethoxyphenol (CAS 1228956-98-6) is a chemical compound with the molecular formula C13H10BrFO2 and a molecular weight of 297.12 g/mol. IUPAC name: 6-bromo-2-fluoro-3-phenylmethoxyphenol. InChIKey: WDWMIQICZJPVHB-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO2 |
|---|---|
| Molecular weight | 297.12 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-phenylmethoxyphenol |
| InChIKey | WDWMIQICZJPVHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)O)F |
Computed by PubChem (NCBI)