cas: 126570-65-8 — see every product listed under this CAS number, including other names
3-(Dibromomethyl)picolinonitrile 95% (CAS 126570-65-8) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100712-5g |
| cas | 126570-65-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 626.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100712 |
3-(dibromomethyl)pyridine-2-carbonitrile (CAS 126570-65-8) is a chemical compound with the molecular formula C7H4Br2N2 and a molecular weight of 275.93 g/mol. IUPAC name: 3-(dibromomethyl)pyridine-2-carbonitrile. InChIKey: KKEWJNRFQAPCSX-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2 |
|---|---|
| Molecular weight | 275.93 g/mol |
| IUPAC name | 3-(dibromomethyl)pyridine-2-carbonitrile |
| InChIKey | KKEWJNRFQAPCSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)C#N)C(Br)Br |
Computed by PubChem (NCBI)