3-(Fluorosulfonyl)benzoic acid 97%
cas: 454-95-5 — see every product listed under this CAS number, including other names
3-(Fluorosulfonyl)benzoic acid 97% (CAS 454-95-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A631462-100mg |
| cas | 454-95-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 25g | 4208.50 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A631462 |
3-fluorosulfonylbenzoic acid (CAS 454-95-5) is a chemical compound with the molecular formula C7H5FO4S and a molecular weight of 204.18 g/mol. IUPAC name: 3-fluorosulfonylbenzoic acid. InChIKey: VWYMBWGOJRULOV-UHFFFAOYSA-N.
| Molecular formula | C7H5FO4S |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 3-fluorosulfonylbenzoic acid |
| InChIKey | VWYMBWGOJRULOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(Fluorosulfonyl)benzoic acid, 3-fluorosulfonylbenzoic acid, 3-(Fluorosulphonyl)benzoic acid, Benzoic acid, 3-(fluorosulfonyl)-, m-(Fluorosulfonyl)benzoic acid, BENZOIC ACID, M-(FLUOROSULFONYL)-, VWYMBWGOJRULOV-UHFFFAOYSA-N, 3-(Fluorosulfonyl)-Benzoic acid, NCIOpen2_004907, 3-(Fluorosulfonyl)benzoicacid