CAS 406927-71-7 appears in our catalog under these names: 3-(5-Chloro-2,4-dimethoxy-phenylsulfamoyl)-benzoic acid, 95%, 3-(N-(5-Chloro-2,4-dimethoxyphenyl)sulfamoyl)benzoic acid, 95%, 3-[(5-CHLORO-2,4-DIMETHOXYPHENYL)SULFAMOYL]BENZOIC ACID, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoic acid (CAS 406927-71-7) is a chemical compound with the molecular formula C15H14ClNO6S and a molecular weight of 371.8 g/mol. IUPAC name: 3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoic acid. InChIKey: RDZVOBQJNHOKQI-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO6S |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | 3-[(5-chloro-2,4-dimethoxyphenyl)sulfamoyl]benzoic acid |
| InChIKey | RDZVOBQJNHOKQI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1NS(=O)(=O)C2=CC=CC(=C2)C(=O)O)Cl)OC |
Computed by PubChem (NCBI)