cas: 1256360-45-8 — see every product listed under this CAS number, including other names
3-(N-Cyclohexylaminomethyl)-2-fluorophenylboronic acid, pinacol ester, 96%, 96% (CAS 1256360-45-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BQW-250mg |
| cas | 1256360-45-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2661.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
N-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine (CAS 1256360-45-8) is a chemical compound with the molecular formula C19H29BFNO2 and a molecular weight of 333.3 g/mol. IUPAC name: N-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine. InChIKey: YVTNLXMDMUUITG-UHFFFAOYSA-N.
| Molecular formula | C19H29BFNO2 |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | N-[[2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]cyclohexanamine |
| InChIKey | YVTNLXMDMUUITG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)CNC3CCCCC3)F |
Computed by PubChem (NCBI)