cas: 4423-09-0 — see every product listed under this CAS number, including other names
3-(P-tolyl)pyridine, 98% (CAS 4423-09-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609765-250MG |
| cas | 4423-09-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1872.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-methylphenyl)pyridine (CAS 4423-09-0) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 3-(4-methylphenyl)pyridine. InChIKey: KUZNURGIXXKBEJ-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 3-(4-methylphenyl)pyridine |
| InChIKey | KUZNURGIXXKBEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)