3-(Phenylethynyl)benzoic acid, 95+%
cas: 93866-50-3 — see every product listed under this CAS number, including other names
3-(Phenylethynyl)benzoic acid, 95+% (CAS 93866-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A467618-100mg |
| cas | 93866-50-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1332.69 Pln | |
| Ambeed | 1g | 4503.31 Pln | |
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 1019.60 Pln | |
| Chemat | 1g | 3851.60 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1436.19 Pln | |
| BLDpharm | 1g | 4851.65 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
3-(2-phenylethynyl)benzoic acid (CAS 93866-50-3) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 3-(2-phenylethynyl)benzoic acid. InChIKey: YVBDUPNCTBINKB-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-(2-phenylethynyl)benzoic acid |
| InChIKey | YVBDUPNCTBINKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
