cas: 25199-76-2 — see every product listed under this CAS number, including other names
3-(TRIFLUOROMETHYL)QUINOLINE, 95%, 95% (CAS 25199-76-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113QV7-50mg |
| cas | 25199-76-2 |
| size | 50mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 251.60 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 1907.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(trifluoromethyl)quinoline (CAS 25199-76-2) is a chemical compound with the molecular formula C10H6F3N and a molecular weight of 197.16 g/mol. IUPAC name: 3-(trifluoromethyl)quinoline. InChIKey: GNURDPNECHIYFK-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 3-(trifluoromethyl)quinoline |
| InChIKey | GNURDPNECHIYFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)C(F)(F)F |
Computed by PubChem (NCBI)