cas: 1598-89-6 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)-α-[3-(trifluoromethyl)phenyl]benzenemethanol, 95%, 95% (CAS 1598-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RF7-100mg |
| cas | 1598-89-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1206.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Bis[3-(trifluoromethyl)phenyl]methanol (CAS 1598-89-6) is a chemical compound with the molecular formula C15H10F6O and a molecular weight of 320.23 g/mol. IUPAC name: bis[3-(trifluoromethyl)phenyl]methanol. InChIKey: WWKAKFGJTVATRV-UHFFFAOYSA-N.
| Molecular formula | C15H10F6O |
|---|---|
| Molecular weight | 320.23 g/mol |
| IUPAC name | bis[3-(trifluoromethyl)phenyl]methanol |
| InChIKey | WWKAKFGJTVATRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C2=CC(=CC=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)