cas: 454-89-7 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)benzaldehyde, 97% (CAS 454-89-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 150g, 250g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 188440050 |
| cas | 454-89-7 |
| size | 5g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 271.28 Pln | |
| Thermo Scientific (Acros) | 25g | 846.35 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 150g | 242.64 Pln | |
| Fluorochem | 250g | 362.39 Pln | |
| Fluorochem | 500g | 539.41 Pln | |
| Fluorochem | 1kg | 966.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-(trifluoromethyl)benzaldehyde (CAS 454-89-7) is a chemical compound with the molecular formula C8H5F3O and a molecular weight of 174.12 g/mol. IUPAC name: 3-(trifluoromethyl)benzaldehyde. InChIKey: NMTUHPSKJJYGML-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)benzaldehyde |
| InChIKey | NMTUHPSKJJYGML-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)