cas: 89570-83-2 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)pyrid-2-ylhydrazine, 97% (CAS 89570-83-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F005557-250MG |
| cas | 89570-83-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 706.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-(trifluoromethyl)-2-pyridinyl]hydrazine (CAS 89570-83-2) is a chemical compound with the molecular formula C6H6F3N3 and a molecular weight of 177.13 g/mol. IUPAC name: [3-(trifluoromethyl)-2-pyridinyl]hydrazine. InChIKey: TWPMJXZSKBAITM-UHFFFAOYSA-N.
| Molecular formula | C6H6F3N3 |
|---|---|
| Molecular weight | 177.13 g/mol |
| IUPAC name | [3-(trifluoromethyl)-2-pyridinyl]hydrazine |
| InChIKey | TWPMJXZSKBAITM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)NN)C(F)(F)F |
Computed by PubChem (NCBI)