cas: 53515-17-6 — see every product listed under this CAS number, including other names
3-(Trifluoromethyl)thiobenzamide (CAS 53515-17-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021349-1G |
| cas | 53515-17-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 799.74 Pln | |
| Fluorochem | 25g | 3288.44 Pln |
| delivery time | 2-3 weeks |
|---|
3-(trifluoromethyl)benzenecarbothioamide (CAS 53515-17-6) is a chemical compound with the molecular formula C8H6F3NS and a molecular weight of 205.20 g/mol. IUPAC name: 3-(trifluoromethyl)benzenecarbothioamide. InChIKey: WOJQBHSZMFRQIR-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NS |
|---|---|
| Molecular weight | 205.20 g/mol |
| IUPAC name | 3-(trifluoromethyl)benzenecarbothioamide |
| InChIKey | WOJQBHSZMFRQIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=S)N |
Computed by PubChem (NCBI)