3-(Trimethoxysilyl)propyl benzoate, 95%
cas: 76241-02-6 — see every product listed under this CAS number, including other names
3-(Trimethoxysilyl)propyl benzoate, 95% (CAS 76241-02-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A149555-5g |
| cas | 76241-02-6 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 882.12 Pln | |
| Ambeed | 100g | 2656.56 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 25g | 923.60 Pln | |
| Chemat | 100g | 2819.60 Pln | |
| BLDpharm | 5g | 319.91 Pln | |
| BLDpharm | 25g | 941.92 Pln | |
| BLDpharm | 100g | 2857.91 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-trimethoxysilylpropyl benzoate (CAS 76241-02-6) is a chemical compound with the molecular formula C13H20O5Si and a molecular weight of 284.38 g/mol. IUPAC name: 3-trimethoxysilylpropyl benzoate. InChIKey: HYFWOBSAALCFRS-UHFFFAOYSA-N.
| Molecular formula | C13H20O5Si |
|---|---|
| Molecular weight | 284.38 g/mol |
| IUPAC name | 3-trimethoxysilylpropyl benzoate |
| InChIKey | HYFWOBSAALCFRS-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCOC(=O)C1=CC=CC=C1)(OC)OC |
Computed by PubChem (NCBI)