cas: 224584-18-3 — see every product listed under this CAS number, including other names
3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 98%, 98% (CAS 224584-18-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5FN-100mg |
| cas | 224584-18-3 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1163.60 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3506.00 Pln | |
| Chemat | 50g | 5646.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 224584-18-3) is a chemical compound with the molecular formula C7H7F3O2 and a molecular weight of 180.12 g/mol. IUPAC name: 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: CGISBZCYXGUFNK-UHFFFAOYSA-N.
| Molecular formula | C7H7F3O2 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 3-(trifluoromethyl)bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | CGISBZCYXGUFNK-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)