cas: 1347750-85-9 — see every product listed under this CAS number, including other names
3-[(17-Hydroxy-3,6,9,12,15-pentaoxaheptadec-1-yl)oxy]propanoic acid, 98%, 98% (CAS 1347750-85-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IT7-100mg |
| cas | 1347750-85-9 |
| size | 100mg |
| availability | 43.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 500mg | 338.00 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2541.20 Pln | |
| Chemat | 25g | 5229.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-85-9) is a chemical compound with the molecular formula C15H30O9 and a molecular weight of 354.39 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: LGLHJMFNIHYJBM-UHFFFAOYSA-N.
| Molecular formula | C15H30O9 |
|---|---|
| Molecular weight | 354.39 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | LGLHJMFNIHYJBM-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCO)C(=O)O |
Computed by PubChem (NCBI)