cas: 227088-94-0 — see every product listed under this CAS number, including other names
3-[1-[[(3'-NItro[1,1'-biphenyl]-4-yl)oxy]methyl]-3-(4-pyridinyl)propyl]-2,4-thiazolidinedione, 95%, 95% (CAS 227088-94-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148S6-100mg |
| cas | 227088-94-0 |
| size | 100mg |
| availability | 1.98g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1782.80 Pln | |
| Chemat | 250mg | 2474.00 Pln | |
| Chemat | 1g | 4888.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-[1-[4-(3-nitrophenyl)phenoxy]-4-pyridin-4-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione (CAS 227088-94-0) is a chemical compound with the molecular formula C24H21N3O5S and a molecular weight of 463.5 g/mol. IUPAC name: 3-[1-[4-(3-nitrophenyl)phenoxy]-4-pyridin-4-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione. InChIKey: VQEHBLGYANQWEA-UHFFFAOYSA-N.
| Molecular formula | C24H21N3O5S |
|---|---|
| Molecular weight | 463.5 g/mol |
| IUPAC name | 3-[1-[4-(3-nitrophenyl)phenoxy]-4-pyridin-4-ylbutan-2-yl]-1,3-thiazolidine-2,4-dione |
| InChIKey | VQEHBLGYANQWEA-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)C(CCC2=CC=NC=C2)COC3=CC=C(C=C3)C4=CC(=CC=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)