cas: 2203140-35-4 — see every product listed under this CAS number, including other names
3-[2-(2-Benzyloxycarbonylaminoethoxy)ethoxy]propionic acid 2,5-dioxo-pyrrolidin-1-yl ester, 97%, 97% (CAS 2203140-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12SXBX-100mg |
| cas | 2203140-35-4 |
| size | 100mg |
| availability | 160g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 683.60 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3923.60 Pln | |
| Chemat | 100g | 6266.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]propanoate (CAS 2203140-35-4) is a chemical compound with the molecular formula C19H24N2O8 and a molecular weight of 408.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]propanoate. InChIKey: WBBHBHVWSBTEFN-UHFFFAOYSA-N.
| Molecular formula | C19H24N2O8 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]propanoate |
| InChIKey | WBBHBHVWSBTEFN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)