cas: 1158264-69-7 — see every product listed under this CAS number, including other names
3-[5-(AMINOMETHYL)-1-OXO-2,3-DIHYDRO-1H-ISOINDOL-2-YL]PIPERIDINE-2,6-DIONE HYDROCHLORIDE, 98% (CAS 1158264-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F845007-100MG |
| cas | 1158264-69-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 534.20 Pln | |
| Fluorochem | 5g | 1606.74 Pln | |
| Fluorochem | 10g | 2939.61 Pln | |
| Fluorochem | 25g | 6157.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (CAS 1158264-69-7) is a chemical compound with the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. IUPAC name: 3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride. InChIKey: XTILEMYXOZKSFJ-UHFFFAOYSA-N.
| Molecular formula | C14H16ClN3O3 |
|---|---|
| Molecular weight | 309.75 g/mol |
| IUPAC name | 3-[6-(aminomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| InChIKey | XTILEMYXOZKSFJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)CN.Cl |
Computed by PubChem (NCBI)