cas: 1100598-48-8 — see every product listed under this CAS number, including other names
3-[5-[(1-METHYL-4-PIPERIDINYL)METHOXY]-2-PYRIMIDINYL]-BENZENEMETHANOL, 97% (CAS 1100598-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467661-100MG |
| cas | 1100598-48-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1820.21 Pln | |
| Fluorochem | 250mg | 2877.13 Pln | |
| Fluorochem | 500mg | 4730.64 Pln | |
| Fluorochem | 1g | 7063.16 Pln | |
| Fluorochem | 5g | 21026.99 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methanol (CAS 1100598-48-8) is a chemical compound with the molecular formula C18H23N3O2 and a molecular weight of 313.4 g/mol. IUPAC name: [3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methanol. InChIKey: RKSFCTQWIPYSLR-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | [3-[5-[(1-methylpiperidin-4-yl)methoxy]pyrimidin-2-yl]phenyl]methanol |
| InChIKey | RKSFCTQWIPYSLR-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)COC2=CN=C(N=C2)C3=CC=CC(=C3)CO |
Computed by PubChem (NCBI)