cas: 95711-07-2 — see every product listed under this CAS number, including other names
3-{[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]oxy}phenol (CAS 95711-07-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010057-500MG |
| cas | 95711-07-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 924.69 Pln | |
| Fluorochem | 1g | 1424.52 Pln |
| delivery time | 2-3 weeks |
|---|
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenol (CAS 95711-07-2) is a chemical compound with the molecular formula C12H7ClF3NO2 and a molecular weight of 289.64 g/mol. IUPAC name: 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenol. InChIKey: PQPVBXCOPBPDTC-UHFFFAOYSA-N.
| Molecular formula | C12H7ClF3NO2 |
|---|---|
| Molecular weight | 289.64 g/mol |
| IUPAC name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]phenol |
| InChIKey | PQPVBXCOPBPDTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=C(C=C(C=N2)C(F)(F)F)Cl)O |
Computed by PubChem (NCBI)