cas: 1864061-72-2 — see every product listed under this CAS number, including other names
3-Acetamido-2-nitrophenyl 4-(benzyl(methyl)amino)-3,5-difluorobenzoate, 97% (CAS 1864061-72-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A858822-5g |
| cas | 1864061-72-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17926.93 Pln | |
| AmBeed | 1g | 5994.10 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3-acetamido-2-nitrophenyl) 4-[benzyl(methyl)amino]-3,5-difluorobenzoate (CAS 1864061-72-2) is a chemical compound with the molecular formula C23H19F2N3O5 and a molecular weight of 455.4 g/mol. IUPAC name: (3-acetamido-2-nitrophenyl) 4-[benzyl(methyl)amino]-3,5-difluorobenzoate. InChIKey: BOCLOAWUCMIZJR-UHFFFAOYSA-N.
| Molecular formula | C23H19F2N3O5 |
|---|---|
| Molecular weight | 455.4 g/mol |
| IUPAC name | (3-acetamido-2-nitrophenyl) 4-[benzyl(methyl)amino]-3,5-difluorobenzoate |
| InChIKey | BOCLOAWUCMIZJR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=CC=C1)OC(=O)C2=CC(=C(C(=C2)F)N(C)CC3=CC=CC=C3)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)