cas: 955287-40-8 — see every product listed under this CAS number, including other names
3-Amino-3-(4-isopropylphenyl)propan-1-ol 97% (CAS 955287-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A884500-100mg |
| cas | 955287-40-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 709.69 Pln | |
| Ambeed | 250mg | 837.62 Pln | |
| Ambeed | 1g | 1744.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A884500 |
3-amino-3-(4-propan-2-ylphenyl)propan-1-ol (CAS 955287-40-8) is a chemical compound with the molecular formula C12H19NO and a molecular weight of 193.28 g/mol. IUPAC name: 3-amino-3-(4-propan-2-ylphenyl)propan-1-ol. InChIKey: TVSIYSBCFQVGGD-UHFFFAOYSA-N.
| Molecular formula | C12H19NO |
|---|---|
| Molecular weight | 193.28 g/mol |
| IUPAC name | 3-amino-3-(4-propan-2-ylphenyl)propan-1-ol |
| InChIKey | TVSIYSBCFQVGGD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(CCO)N |
Computed by PubChem (NCBI)