cas: 175135-08-7 — see every product listed under this CAS number, including other names
3-Amino-4-(2-methoxyphenoxy)benzotrifluoride (CAS 175135-08-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F003999-250MG |
| cas | 175135-08-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 299.91 Pln |
| delivery time | 2-3 weeks |
|---|
2-(2-methoxyphenoxy)-5-(trifluoromethyl)aniline (CAS 175135-08-7) is a chemical compound with the molecular formula C14H12F3NO2 and a molecular weight of 283.24 g/mol. IUPAC name: 2-(2-methoxyphenoxy)-5-(trifluoromethyl)aniline. InChIKey: PYNDGRAUAXTKAO-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO2 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 2-(2-methoxyphenoxy)-5-(trifluoromethyl)aniline |
| InChIKey | PYNDGRAUAXTKAO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)