cas: 143173-93-7 — see every product listed under this CAS number, including other names
3-Amino-N-butylbenzenesulfonamide, 98% (CAS 143173-93-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 500g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A639327-5g |
| cas | 143173-93-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 323.89 Pln | |
| AmBeed | 1g | 200.20 Pln | |
| AmBeed | 500g | 8413.74 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-amino-N-butylbenzenesulfonamide (CAS 143173-93-7) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 3-amino-N-butylbenzenesulfonamide. InChIKey: WGOUCTJBESOZIL-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 3-amino-N-butylbenzenesulfonamide |
| InChIKey | WGOUCTJBESOZIL-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)