cas: 608523-94-0 — see every product listed under this CAS number, including other names
3-Amino-N-tert-butyl-benzenesulfonamide, 97% (CAS 608523-94-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F059621-5G |
| cas | 608523-94-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 565.44 Pln | |
| Fluorochem | 25g | 1101.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-amino-N-tert-butylbenzenesulfonamide (CAS 608523-94-0) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 3-amino-N-tert-butylbenzenesulfonamide. InChIKey: KLQVFEHOLLUULE-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 3-amino-N-tert-butylbenzenesulfonamide |
| InChIKey | KLQVFEHOLLUULE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)