CAS 65600-69-3 appears in our catalog under these names: 3-Aminopyridine 1-oxide hydrochloride, 95%, 3–aminopyridin–1–ium–1–olate hydrochloride, 3-Aminopyridin-1-ium-1-olate hydrochloride, 3-aminopyridin-1-ium-1-olate hydrochloride, 95%, 95%. Offered by: Fluorochem, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 1g, 2,5g.
1-oxidopyridin-1-ium-3-amine;hydrochloride (CAS 65600-69-3) is a chemical compound with the molecular formula C5H7ClN2O and a molecular weight of 146.57 g/mol. IUPAC name: 1-oxidopyridin-1-ium-3-amine;hydrochloride. InChIKey: KQGFTAJGCKDUSW-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O |
|---|---|
| Molecular weight | 146.57 g/mol |
| IUPAC name | 1-oxidopyridin-1-ium-3-amine;hydrochloride |
| InChIKey | KQGFTAJGCKDUSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C[N+](=C1)[O-])N.Cl |
Computed by PubChem (NCBI)