cas: 929884-81-1 — see every product listed under this CAS number, including other names
3-BROMO-4-FLUOROBENZAMIDINE HCL, 95% (CAS 929884-81-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306658-100MG |
| cas | 929884-81-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1158.98 Pln | |
| Fluorochem | 250mg | 1913.93 Pln | |
| Fluorochem | 1g | 6136.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-bromo-4-fluorobenzenecarboximidamide;hydrochloride (CAS 929884-81-1) is a chemical compound with the molecular formula C7H7BrClFN2 and a molecular weight of 253.50 g/mol. IUPAC name: 3-bromo-4-fluorobenzenecarboximidamide;hydrochloride. InChIKey: JUBGLWYEKFVADT-UHFFFAOYSA-N.
| Molecular formula | C7H7BrClFN2 |
|---|---|
| Molecular weight | 253.50 g/mol |
| IUPAC name | 3-bromo-4-fluorobenzenecarboximidamide;hydrochloride |
| InChIKey | JUBGLWYEKFVADT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=N)N)Br)F.Cl |
Computed by PubChem (NCBI)