cas: 219492-12-3 — see every product listed under this CAS number, including other names
3-Benzyloxy-4-methyl-aniline, 95% (CAS 219492-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047500-100MG |
| cas | 219492-12-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 169.75 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2580.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-methyl-3-phenylmethoxyaniline (CAS 219492-12-3) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: 4-methyl-3-phenylmethoxyaniline. InChIKey: TZWRMTAIHRIAFC-UHFFFAOYSA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 4-methyl-3-phenylmethoxyaniline |
| InChIKey | TZWRMTAIHRIAFC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)