cas: 916792-34-2 — see every product listed under this CAS number, including other names
3-Benzyloxy-4-methylbenzyl alcohol (CAS 916792-34-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633289-1G |
| cas | 916792-34-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3345.71 Pln | |
| Fluorochem | 5g | 9890.29 Pln |
| delivery time | 3-4 weeks |
|---|
(4-methyl-3-phenylmethoxyphenyl)methanol (CAS 916792-34-2) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. IUPAC name: (4-methyl-3-phenylmethoxyphenyl)methanol. InChIKey: GBVCRKCGVJJDFL-UHFFFAOYSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | (4-methyl-3-phenylmethoxyphenyl)methanol |
| InChIKey | GBVCRKCGVJJDFL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CO)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)