cas: 874289-56-2 — see every product listed under this CAS number, including other names
3-Borono-4-fluorobenzohydrazide 95% (CAS 874289-56-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A172740-250mg |
| cas | 874289-56-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A172740 |
[2-fluoro-5-(hydrazinecarbonyl)phenyl]boronic acid (CAS 874289-56-2) is a chemical compound with the molecular formula C7H8BFN2O3 and a molecular weight of 197.96 g/mol. IUPAC name: [2-fluoro-5-(hydrazinecarbonyl)phenyl]boronic acid. InChIKey: MAVMVAKNYGFECD-UHFFFAOYSA-N.
| Molecular formula | C7H8BFN2O3 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | [2-fluoro-5-(hydrazinecarbonyl)phenyl]boronic acid |
| InChIKey | MAVMVAKNYGFECD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)NN)F)(O)O |
Computed by PubChem (NCBI)