3-Bromo-1-(naphthalen-1-yl)-1H-indole, 95%
cas: 2845126-51-2 — see every product listed under this CAS number, including other names
3-Bromo-1-(naphthalen-1-yl)-1H-indole, 95% (CAS 2845126-51-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1556501-250mg |
| cas | 2845126-51-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 553.94 Pln | |
| Ambeed | 5g | 1755.44 Pln | |
| Ambeed | 25g | 6099.75 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1552.40 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 542.06 Pln | |
| BLDpharm | 5g | 1724.97 Pln | |
| BLDpharm | 25g | 5984.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-bromo-1-naphthalen-1-ylindole (CAS 2845126-51-2) is a chemical compound with the molecular formula C18H12BrN and a molecular weight of 322.2 g/mol. IUPAC name: 3-bromo-1-naphthalen-1-ylindole. InChIKey: JNBFLYFLJLAKBQ-UHFFFAOYSA-N.
| Molecular formula | C18H12BrN |
|---|---|
| Molecular weight | 322.2 g/mol |
| IUPAC name | 3-bromo-1-naphthalen-1-ylindole |
| InChIKey | JNBFLYFLJLAKBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C=C(C4=CC=CC=C43)Br |
Computed by PubChem (NCBI)