cas: 1214330-62-7 — see every product listed under this CAS number, including other names
3-Bromo-2,4-dichloro-6-(trifluoromethyl)pyridine, ≥95%, ≥95% (CAS 1214330-62-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1125SG-100mg |
| cas | 1214330-62-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1221.20 Pln | |
| Chemat | 1g | 2958.80 Pln | |
| Chemat | 5g | 7643.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-bromo-2,4-dichloro-6-(trifluoromethyl)pyridine (CAS 1214330-62-7) is a chemical compound with the molecular formula C6HBrCl2F3N and a molecular weight of 294.88 g/mol. IUPAC name: 3-bromo-2,4-dichloro-6-(trifluoromethyl)pyridine. InChIKey: SWRQXBKMDSJSHC-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl2F3N |
|---|---|
| Molecular weight | 294.88 g/mol |
| IUPAC name | 3-bromo-2,4-dichloro-6-(trifluoromethyl)pyridine |
| InChIKey | SWRQXBKMDSJSHC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1C(F)(F)F)Cl)Br)Cl |
Computed by PubChem (NCBI)