cas: 1226808-64-5 — see every product listed under this CAS number, including other names
3-Bromo-2-(methylthio)-5-(trifluoromethyl)pyridine 97% (CAS 1226808-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A507615-250mg |
| cas | 1226808-64-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 292.50 Pln | |
| Ambeed | 5g | 698.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A507615 |
3-bromo-2-methylsulfanyl-5-(trifluoromethyl)pyridine (CAS 1226808-64-5) is a chemical compound with the molecular formula C7H5BrF3NS and a molecular weight of 272.09 g/mol. IUPAC name: 3-bromo-2-methylsulfanyl-5-(trifluoromethyl)pyridine. InChIKey: PGEREEIUJMZQTJ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NS |
|---|---|
| Molecular weight | 272.09 g/mol |
| IUPAC name | 3-bromo-2-methylsulfanyl-5-(trifluoromethyl)pyridine |
| InChIKey | PGEREEIUJMZQTJ-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)