cas: 944902-17-4 — see every product listed under this CAS number, including other names
3-Bromo-4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine 95% (CAS 944902-17-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A118045-100mg |
| cas | 944902-17-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 720.81 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2667.69 Pln | |
| Ambeed | 100g | 8385.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A118045 |
3-bromo-4,6-dichloro-2H-pyrazolo[3,4-d]pyrimidine (CAS 944902-17-4) is a chemical compound with the molecular formula C5HBrCl2N4 and a molecular weight of 267.90 g/mol. IUPAC name: 3-bromo-4,6-dichloro-2H-pyrazolo[3,4-d]pyrimidine. InChIKey: XTVZOIZUAZZTOX-UHFFFAOYSA-N.
| Molecular formula | C5HBrCl2N4 |
|---|---|
| Molecular weight | 267.90 g/mol |
| IUPAC name | 3-bromo-4,6-dichloro-2H-pyrazolo[3,4-d]pyrimidine |
| InChIKey | XTVZOIZUAZZTOX-UHFFFAOYSA-N |
| SMILES | C12=C(NN=C1N=C(N=C2Cl)Cl)Br |
Computed by PubChem (NCBI)